C10H14ClNO3S2 — CID 82745840
5-(chloromethyl)-N-methyl-N-(oxolan-3-yl)thiophene-3-sulfonamide (PubChem CID 82745840) has the molecular formula C10H14ClNO3S2 and a molecular weight of 295.81 g/mol. Its IUPAC name is 5-(chloromethyl)-N-methyl-N-(oxolan-3-yl)thiophene-3-sulfonamide.
| Compound Name | 5-(chloromethyl)-N-methyl-N-(oxolan-3-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 82745840 |
| Molecular Formula | C10H14ClNO3S2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 5-(chloromethyl)-N-methyl-N-(oxolan-3-yl)thiophene-3-sulfonamide |
| SMILES | CN(C1CCOC1)S(=O)(=O)c1csc(CCl)c1 |
| InChI | InChI=1S/C10H14ClNO3S2/c1-12(8-2-3-15-6-8)17(13,14)10-4-9(5-11)16-7-10/h4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | CRODPBVZLUMNMI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|