C16H22ClN3O3S — CID 121154164
1-[1-(3-chloro-2-methylphenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide (PubChem CID 121154164) has the molecular formula C16H22ClN3O3S and a molecular weight of 371.89 g/mol. Its IUPAC name is 1-[1-(3-chloro-2-methylphenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-(3-chloro-2-methylphenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 121154164 |
| Molecular Formula | C16H22ClN3O3S |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 1-[1-(3-chloro-2-methylphenyl)sulfonylazetidin-3-yl]piperidine-4-carboxamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CC(N2CCC(C(N)=O)CC2)C1 |
| InChI | InChI=1S/C16H22ClN3O3S/c1-11-14(17)3-2-4-15(11)24(22,23)20-9-13(10-20)19-7-5-12(6-8-19)16(18)21/h2-4,12-13H,5-10H2,1H3,(H2,18,21) |
| InChIKey | NCIMJOCFHHCNIG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |