C12H16ClNO4S2 — CID 97354839
(3S)-1-(3-chloro-2-methylphenyl)sulfonyl-3-methylsulfonylpyrrolidine (PubChem CID 97354839) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is (3S)-1-(3-chloro-2-methylphenyl)sulfonyl-3-methylsulfonylpyrrolidine.
| Compound Name | (3S)-1-(3-chloro-2-methylphenyl)sulfonyl-3-methylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 97354839 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | (3S)-1-(3-chloro-2-methylphenyl)sulfonyl-3-methylsulfonylpyrrolidine |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CC[C@H](S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H16ClNO4S2/c1-9-11(13)4-3-5-12(9)20(17,18)14-7-6-10(8-14)19(2,15)16/h3-5,10H,6-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | IRDLNTHBVUMVIT-JTQLQIEISA-N |
| XLogP | 1.46 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |