C16H18ClN3O4S — CID 90637208
2-[1-(3-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxy-3-methoxypyrazine (PubChem CID 90637208) has the molecular formula C16H18ClN3O4S and a molecular weight of 383.86 g/mol. Its IUPAC name is 2-[1-(3-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxy-3-methoxypyrazine.
| Compound Name | 2-[1-(3-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxy-3-methoxypyrazine |
|---|---|
| PubChem CID | 90637208 |
| Molecular Formula | C16H18ClN3O4S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[1-(3-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxy-3-methoxypyrazine |
| SMILES | COc1nccnc1OC1CCN(S(=O)(=O)c2cccc(Cl)c2C)C1 |
| InChI | InChI=1S/C16H18ClN3O4S/c1-11-13(17)4-3-5-14(11)25(21,22)20-9-6-12(10-20)24-16-15(23-2)18-7-8-19-16/h3-5,7-8,12H,6,9-10H2,1-2H3 |
| InChIKey | HTIWZYIXKYHVEK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |