C16H15ClN4O3S — CID 90636786
3-[1-(3-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine-2-carbonitrile (PubChem CID 90636786) has the molecular formula C16H15ClN4O3S and a molecular weight of 378.84 g/mol. Its IUPAC name is 3-[1-(3-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine-2-carbonitrile.
| Compound Name | 3-[1-(3-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 90636786 |
| Molecular Formula | C16H15ClN4O3S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 3-[1-(3-chloro-2-methylphenyl)sulfonylpyrrolidin-3-yl]oxypyrazine-2-carbonitrile |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)N1CCC(Oc2nccnc2C#N)C1 |
| InChI | InChI=1S/C16H15ClN4O3S/c1-11-13(17)3-2-4-15(11)25(22,23)21-8-5-12(10-21)24-16-14(9-18)19-6-7-20-16/h2-4,6-7,12H,5,8,10H2,1H3 |
| InChIKey | KLXFOGUXQCXYDU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |