C18H19N5O4S — CID 90636815
N-[4-[3-(3-cyanopyrazin-2-yl)oxypyrrolidin-1-yl]sulfonyl-3-methylphenyl]acetamide (PubChem CID 90636815) has the molecular formula C18H19N5O4S and a molecular weight of 401.45 g/mol. Its IUPAC name is N-[4-[3-(3-cyanopyrazin-2-yl)oxypyrrolidin-1-yl]sulfonyl-3-methylphenyl]acetamide.
| Compound Name | N-[4-[3-(3-cyanopyrazin-2-yl)oxypyrrolidin-1-yl]sulfonyl-3-methylphenyl]acetamide |
|---|---|
| PubChem CID | 90636815 |
| Molecular Formula | C18H19N5O4S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[4-[3-(3-cyanopyrazin-2-yl)oxypyrrolidin-1-yl]sulfonyl-3-methylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC(Oc3nccnc3C#N)C2)c(C)c1 |
| InChI | InChI=1S/C18H19N5O4S/c1-12-9-14(22-13(2)24)3-4-17(12)28(25,26)23-8-5-15(11-23)27-18-16(10-19)20-6-7-21-18/h3-4,6-7,9,15H,5,8,11H2,1-2H3,(H,22,24) |
| InChIKey | KECIYJAZZMPICZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |