C18H22N4O5S — CID 90637690
N-[4-[3-(6-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]sulfonyl-3-methylphenyl]acetamide (PubChem CID 90637690) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[4-[3-(6-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]sulfonyl-3-methylphenyl]acetamide.
| Compound Name | N-[4-[3-(6-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]sulfonyl-3-methylphenyl]acetamide |
|---|---|
| PubChem CID | 90637690 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[4-[3-(6-methoxypyrazin-2-yl)oxypyrrolidin-1-yl]sulfonyl-3-methylphenyl]acetamide |
| SMILES | COc1cncc(OC2CCN(S(=O)(=O)c3ccc(NC(C)=O)cc3C)C2)n1 |
| InChI | InChI=1S/C18H22N4O5S/c1-12-8-14(20-13(2)23)4-5-16(12)28(24,25)22-7-6-15(11-22)27-18-10-19-9-17(21-18)26-3/h4-5,8-10,15H,6-7,11H2,1-3H3,(H,20,23) |
| InChIKey | SPGYVXAQGGDABM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |