C14H14N4O3S2 — CID 100652937
3-[(3R)-1-thiophen-2-ylsulfonylpiperidin-3-yl]oxypyrazine-2-carbonitrile (PubChem CID 100652937) has the molecular formula C14H14N4O3S2 and a molecular weight of 350.43 g/mol. Its IUPAC name is 3-[(3R)-1-thiophen-2-ylsulfonylpiperidin-3-yl]oxypyrazine-2-carbonitrile.
| Compound Name | 3-[(3R)-1-thiophen-2-ylsulfonylpiperidin-3-yl]oxypyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 100652937 |
| Molecular Formula | C14H14N4O3S2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 3-[(3R)-1-thiophen-2-ylsulfonylpiperidin-3-yl]oxypyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1O[C@@H]1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C14H14N4O3S2/c15-9-12-14(17-6-5-16-12)21-11-3-1-7-18(10-11)23(19,20)13-4-2-8-22-13/h2,4-6,8,11H,1,3,7,10H2/t11-/m1/s1 |
| InChIKey | APPFLMUXLLMNMY-LLVKDONJSA-N |
| XLogP | 1.64 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |