C20H21N5O4S — CID 90636584
3-[1-(4-pyrrolidin-1-ylsulfonylbenzoyl)pyrrolidin-3-yl]oxypyrazine-2-carbonitrile (PubChem CID 90636584) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is 3-[1-(4-pyrrolidin-1-ylsulfonylbenzoyl)pyrrolidin-3-yl]oxypyrazine-2-carbonitrile.
| Compound Name | 3-[1-(4-pyrrolidin-1-ylsulfonylbenzoyl)pyrrolidin-3-yl]oxypyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 90636584 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 3-[1-(4-pyrrolidin-1-ylsulfonylbenzoyl)pyrrolidin-3-yl]oxypyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1OC1CCN(C(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C20H21N5O4S/c21-13-18-19(23-9-8-22-18)29-16-7-12-24(14-16)20(26)15-3-5-17(6-4-15)30(27,28)25-10-1-2-11-25/h3-6,8-9,16H,1-2,7,10-12,14H2 |
| InChIKey | GWNJFRKVFNSQPJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 116.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |