C13H14FN3O3S2 — CID 122258626
5-fluoro-2-(1-thiophen-2-ylsulfonylpiperidin-3-yl)oxypyrimidine (PubChem CID 122258626) has the molecular formula C13H14FN3O3S2 and a molecular weight of 343.41 g/mol. Its IUPAC name is 5-fluoro-2-(1-thiophen-2-ylsulfonylpiperidin-3-yl)oxypyrimidine.
| Compound Name | 5-fluoro-2-(1-thiophen-2-ylsulfonylpiperidin-3-yl)oxypyrimidine |
|---|---|
| PubChem CID | 122258626 |
| Molecular Formula | C13H14FN3O3S2 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 5-fluoro-2-(1-thiophen-2-ylsulfonylpiperidin-3-yl)oxypyrimidine |
| SMILES | O=S(=O)(c1cccs1)N1CCCC(Oc2ncc(F)cn2)C1 |
| InChI | InChI=1S/C13H14FN3O3S2/c14-10-7-15-13(16-8-10)20-11-3-1-5-17(9-11)22(18,19)12-4-2-6-21-12/h2,4,6-8,11H,1,3,5,9H2 |
| InChIKey | PCKHUYZGTPQOII-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |