C20H23N5O3 — CID 90636747
N-(4-butoxyphenyl)-3-(3-cyanopyrazin-2-yl)oxypyrrolidine-1-carboxamide (PubChem CID 90636747) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-3-(3-cyanopyrazin-2-yl)oxypyrrolidine-1-carboxamide.
| Compound Name | N-(4-butoxyphenyl)-3-(3-cyanopyrazin-2-yl)oxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 90636747 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-(4-butoxyphenyl)-3-(3-cyanopyrazin-2-yl)oxypyrrolidine-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)N2CCC(Oc3nccnc3C#N)C2)cc1 |
| InChI | InChI=1S/C20H23N5O3/c1-2-3-12-27-16-6-4-15(5-7-16)24-20(26)25-11-8-17(14-25)28-19-18(13-21)22-9-10-23-19/h4-7,9-10,17H,2-3,8,11-12,14H2,1H3,(H,24,26) |
| InChIKey | KUZOXDJVGSJVPX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 100.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|