C15H21ClN2O4S2 — CID 146211749
N-[[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide (PubChem CID 146211749) has the molecular formula C15H21ClN2O4S2 and a molecular weight of 392.93 g/mol. Its IUPAC name is N-[[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146211749 |
| Molecular Formula | C15H21ClN2O4S2 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-[[1-(3-chloro-2-methylphenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NCC1CCCN(S(=O)(=O)c2cccc(Cl)c2C)C1 |
| InChI | InChI=1S/C15H21ClN2O4S2/c1-3-23(19,20)17-10-13-6-5-9-18(11-13)24(21,22)15-8-4-7-14(16)12(15)2/h3-4,7-8,13,17H,1,5-6,9-11H2,2H3 |
| InChIKey | WXZGTPIKTRDIIM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |