C15H18ClN3O4S2 — CID 146211737
N-[[1-(2-chloro-4-cyanophenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide (PubChem CID 146211737) has the molecular formula C15H18ClN3O4S2 and a molecular weight of 403.91 g/mol. Its IUPAC name is N-[[1-(2-chloro-4-cyanophenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[1-(2-chloro-4-cyanophenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146211737 |
| Molecular Formula | C15H18ClN3O4S2 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | N-[[1-(2-chloro-4-cyanophenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NCC1CCCN(S(=O)(=O)c2ccc(C#N)cc2Cl)C1 |
| InChI | InChI=1S/C15H18ClN3O4S2/c1-2-24(20,21)18-10-13-4-3-7-19(11-13)25(22,23)15-6-5-12(9-17)8-14(15)16/h2,5-6,8,13,18H,1,3-4,7,10-11H2 |
| InChIKey | JJIVRQIUNTUZKJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |