C15H21ClN2O4S — CID 119961224
methyl 3-chloro-4-[3-(methylaminomethyl)piperidin-1-yl]sulfonylbenzoate (PubChem CID 119961224) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is methyl 3-chloro-4-[3-(methylaminomethyl)piperidin-1-yl]sulfonylbenzoate.
| Compound Name | methyl 3-chloro-4-[3-(methylaminomethyl)piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 119961224 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | methyl 3-chloro-4-[3-(methylaminomethyl)piperidin-1-yl]sulfonylbenzoate |
| SMILES | CNCC1CCCN(S(=O)(=O)c2ccc(C(=O)OC)cc2Cl)C1 |
| InChI | InChI=1S/C15H21ClN2O4S/c1-17-9-11-4-3-7-18(10-11)23(20,21)14-6-5-12(8-13(14)16)15(19)22-2/h5-6,8,11,17H,3-4,7,9-10H2,1-2H3 |
| InChIKey | JWTASNHLMZJJEI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |