C15H22N2O4S2 — CID 146211158
N-[[(3R)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide (PubChem CID 146211158) has the molecular formula C15H22N2O4S2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[[(3R)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[(3R)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146211158 |
| Molecular Formula | C15H22N2O4S2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | N-[[(3R)-1-(4-methylphenyl)sulfonylpiperidin-3-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC[C@H]1CCCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C15H22N2O4S2/c1-3-22(18,19)16-11-14-5-4-10-17(12-14)23(20,21)15-8-6-13(2)7-9-15/h3,6-9,14,16H,1,4-5,10-12H2,2H3/t14-/m1/s1 |
| InChIKey | PRTQIXZOXQRNNS-CQSZACIVSA-N |
| XLogP | 1.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |