C14H20N2O3S2 — CID 146210592
N-[[(3R)-1-(4-methylphenyl)sulfinylpyrrolidin-3-yl]methyl]ethenesulfonamide (PubChem CID 146210592) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[[(3R)-1-(4-methylphenyl)sulfinylpyrrolidin-3-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[(3R)-1-(4-methylphenyl)sulfinylpyrrolidin-3-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146210592 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-[[(3R)-1-(4-methylphenyl)sulfinylpyrrolidin-3-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC[C@H]1CCN(S(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-3-21(18,19)15-10-13-8-9-16(11-13)20(17)14-6-4-12(2)5-7-14/h3-7,13,15H,1,8-11H2,2H3/t13-,20?/m1/s1 |
| InChIKey | MYSHTZMWZRKZJR-CRIUFTBBSA-N |
| XLogP | 1.40 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |