C11H16N2O4S3 — CID 146210607
N-[[(3R)-1-thiophen-2-ylsulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide (PubChem CID 146210607) has the molecular formula C11H16N2O4S3 and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[[(3R)-1-thiophen-2-ylsulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[(3R)-1-thiophen-2-ylsulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146210607 |
| Molecular Formula | C11H16N2O4S3 |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | N-[[(3R)-1-thiophen-2-ylsulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC[C@H]1CCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C11H16N2O4S3/c1-2-19(14,15)12-8-10-5-6-13(9-10)20(16,17)11-4-3-7-18-11/h2-4,7,10,12H,1,5-6,8-9H2/t10-/m1/s1 |
| InChIKey | DHXYGBGECPWBAQ-SNVBAGLBSA-N |
| XLogP | 0.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |