C13H19N3O5S2 — CID 146211907
N-[[(3R)-1-[3-(hydroxyamino)phenyl]sulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide (PubChem CID 146211907) has the molecular formula C13H19N3O5S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is N-[[(3R)-1-[3-(hydroxyamino)phenyl]sulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[(3R)-1-[3-(hydroxyamino)phenyl]sulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146211907 |
| Molecular Formula | C13H19N3O5S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-[[(3R)-1-[3-(hydroxyamino)phenyl]sulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC[C@H]1CCN(S(=O)(=O)c2cccc(NO)c2)C1 |
| InChI | InChI=1S/C13H19N3O5S2/c1-2-22(18,19)14-9-11-6-7-16(10-11)23(20,21)13-5-3-4-12(8-13)15-17/h2-5,8,11,14-15,17H,1,6-7,9-10H2/t11-/m1/s1 |
| InChIKey | FYYLEUZGCWSNSW-LLVKDONJSA-N |
| XLogP | 0.56 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|