C14H20N2O5S2 — CID 146211401
N-[[(3R)-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide (PubChem CID 146211401) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[[(3R)-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide.
| Compound Name | N-[[(3R)-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide |
|---|---|
| PubChem CID | 146211401 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-[[(3R)-1-(3-methoxyphenyl)sulfonylpyrrolidin-3-yl]methyl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)NC[C@H]1CCN(S(=O)(=O)c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-3-22(17,18)15-10-12-7-8-16(11-12)23(19,20)14-6-4-5-13(9-14)21-2/h3-6,9,12,15H,1,7-8,10-11H2,2H3/t12-/m1/s1 |
| InChIKey | DPIGVTZJMCCREF-GFCCVEGCSA-N |
| XLogP | 0.77 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |