C14H22N4O2S2 — CID 120973075
2-(2-methylprop-2-enyl)-1-[(1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]guanidine (PubChem CID 120973075) has the molecular formula C14H22N4O2S2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 2-(2-methylprop-2-enyl)-1-[(1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]guanidine.
| Compound Name | 2-(2-methylprop-2-enyl)-1-[(1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 120973075 |
| Molecular Formula | C14H22N4O2S2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-(2-methylprop-2-enyl)-1-[(1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]guanidine |
| SMILES | C=C(C)C/N=C(\N)NCC1CCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C14H22N4O2S2/c1-11(2)8-16-14(15)17-9-12-5-6-18(10-12)22(19,20)13-4-3-7-21-13/h3-4,7,12H,1,5-6,8-10H2,2H3,(H3,15,16,17) |
| InChIKey | NGNXOLWTQYLWMG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|