C10H17ClN2O2S2 — CID 119984000
3-methyl-1-thiophen-2-ylsulfonylpiperidin-4-amine;hydrochloride (PubChem CID 119984000) has the molecular formula C10H17ClN2O2S2 and a molecular weight of 296.84 g/mol. Its IUPAC name is 3-methyl-1-thiophen-2-ylsulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | 3-methyl-1-thiophen-2-ylsulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119984000 |
| Molecular Formula | C10H17ClN2O2S2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-methyl-1-thiophen-2-ylsulfonylpiperidin-4-amine;hydrochloride |
| SMILES | CC1CN(S(=O)(=O)c2cccs2)CCC1N.Cl |
| InChI | InChI=1S/C10H16N2O2S2.ClH/c1-8-7-12(5-4-9(8)11)16(13,14)10-3-2-6-15-10;/h2-3,6,8-9H,4-5,7,11H2,1H3;1H |
| InChIKey | FCNYYQUUALIITH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |