C13H16N2O4S4 — CID 42930811
2-methyl-1,4-bis(thiophen-2-ylsulfonyl)piperazine (PubChem CID 42930811) has the molecular formula C13H16N2O4S4 and a molecular weight of 392.55 g/mol. Its IUPAC name is 2-methyl-1,4-bis(thiophen-2-ylsulfonyl)piperazine.
| Compound Name | 2-methyl-1,4-bis(thiophen-2-ylsulfonyl)piperazine |
|---|---|
| PubChem CID | 42930811 |
| Molecular Formula | C13H16N2O4S4 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 2-methyl-1,4-bis(thiophen-2-ylsulfonyl)piperazine |
| SMILES | CC1CN(S(=O)(=O)c2cccs2)CCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H16N2O4S4/c1-11-10-14(22(16,17)12-4-2-8-20-12)6-7-15(11)23(18,19)13-5-3-9-21-13/h2-5,8-9,11H,6-7,10H2,1H3 |
| InChIKey | KJMBVJLBTZRVEO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |