C11H18N2O2S2 — CID 114960944
(4-methyl-1-thiophen-2-ylsulfonylpiperidin-3-yl)methanamine (PubChem CID 114960944) has the molecular formula C11H18N2O2S2 and a molecular weight of 274.41 g/mol. Its IUPAC name is (4-methyl-1-thiophen-2-ylsulfonylpiperidin-3-yl)methanamine.
| Compound Name | (4-methyl-1-thiophen-2-ylsulfonylpiperidin-3-yl)methanamine |
|---|---|
| PubChem CID | 114960944 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (4-methyl-1-thiophen-2-ylsulfonylpiperidin-3-yl)methanamine |
| SMILES | CC1CCN(S(=O)(=O)c2cccs2)CC1CN |
| InChI | InChI=1S/C11H18N2O2S2/c1-9-4-5-13(8-10(9)7-12)17(14,15)11-3-2-6-16-11/h2-3,6,9-10H,4-5,7-8,12H2,1H3 |
| InChIKey | BLSQNSBXEUZXDW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |