C16H20N2O2S2 — CID 4538990
2-methyl-1-(3-methylphenyl)-4-thiophen-2-ylsulfonylpiperazine (PubChem CID 4538990) has the molecular formula C16H20N2O2S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-methyl-1-(3-methylphenyl)-4-thiophen-2-ylsulfonylpiperazine.
| Compound Name | 2-methyl-1-(3-methylphenyl)-4-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 4538990 |
| Molecular Formula | C16H20N2O2S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 2-methyl-1-(3-methylphenyl)-4-thiophen-2-ylsulfonylpiperazine |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)c3cccs3)CC2C)c1 |
| InChI | InChI=1S/C16H20N2O2S2/c1-13-5-3-6-15(11-13)18-9-8-17(12-14(18)2)22(19,20)16-7-4-10-21-16/h3-7,10-11,14H,8-9,12H2,1-2H3 |
| InChIKey | OSZMNCAOJXMWPD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |