C18H21F3N2O3S2 — CID 56932932
1,1,1-trifluoro-2-[4-[(2S)-2-methyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 56932932) has the molecular formula C18H21F3N2O3S2 and a molecular weight of 434.51 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[4-[(2S)-2-methyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[4-[(2S)-2-methyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 56932932 |
| Molecular Formula | C18H21F3N2O3S2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 1,1,1-trifluoro-2-[4-[(2S)-2-methyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cccs2)CCN1c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H21F3N2O3S2/c1-13-12-22(28(25,26)16-4-3-11-27-16)9-10-23(13)15-7-5-14(6-8-15)17(2,24)18(19,20)21/h3-8,11,13,24H,9-10,12H2,1-2H3/t13-,17?/m0/s1 |
| InChIKey | WAVKEANTCLSSBK-CWQZNGJJSA-N |
| XLogP | 3.42 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|