C24H25F3N2O3S3 — CID 70655402
(2R)-1,1,1-trifluoro-2-[4-[(2R)-2-(phenylsulfanylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 70655402) has the molecular formula C24H25F3N2O3S3 and a molecular weight of 542.67 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-[4-[(2R)-2-(phenylsulfanylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-2-[4-[(2R)-2-(phenylsulfanylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70655402 |
| Molecular Formula | C24H25F3N2O3S3 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-[4-[(2R)-2-(phenylsulfanylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@@](O)(c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CSc2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H25F3N2O3S3/c1-23(30,24(25,26)27)18-9-11-19(12-10-18)29-14-13-28(35(31,32)22-8-5-15-33-22)16-20(29)17-34-21-6-3-2-4-7-21/h2-12,15,20,30H,13-14,16-17H2,1H3/t20-,23-/m1/s1 |
| InChIKey | WZDOIMSZNKOQLK-NFBKMPQASA-N |
| XLogP | 5.19 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|