C24H24F4N2O3S2 — CID 66582387
1,1,1-trifluoro-2-[4-[(2S)-2-[(4-fluorophenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 66582387) has the molecular formula C24H24F4N2O3S2 and a molecular weight of 528.59 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[4-[(2S)-2-[(4-fluorophenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[4-[(2S)-2-[(4-fluorophenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 66582387 |
| Molecular Formula | C24H24F4N2O3S2 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 1,1,1-trifluoro-2-[4-[(2S)-2-[(4-fluorophenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2Cc2ccc(F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H24F4N2O3S2/c1-23(31,24(26,27)28)18-6-10-20(11-7-18)30-13-12-29(35(32,33)22-3-2-14-34-22)16-21(30)15-17-4-8-19(25)9-5-17/h2-11,14,21,31H,12-13,15-16H2,1H3/t21-,23?/m0/s1 |
| InChIKey | SZRZQUNKKHINOS-BBQAJUCSSA-N |
| XLogP | 4.78 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|