C24H22F6N2O4S2 — CID 87058766
4-[[(2S)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]phenol (PubChem CID 87058766) has the molecular formula C24H22F6N2O4S2 and a molecular weight of 580.57 g/mol. Its IUPAC name is 4-[[(2S)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]phenol.
| Compound Name | 4-[[(2S)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 87058766 |
| Molecular Formula | C24H22F6N2O4S2 |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 4-[[(2S)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]phenol |
| SMILES | O=S(=O)(c1cccs1)N1CCN(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@@H](Cc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C24H22F6N2O4S2/c25-23(26,27)22(34,24(28,29)30)17-5-7-18(8-6-17)32-12-11-31(38(35,36)21-2-1-13-37-21)15-19(32)14-16-3-9-20(33)10-4-16/h1-10,13,19,33-34H,11-12,14-15H2/t19-/m0/s1 |
| InChIKey | SBSZTSRQMMKWHY-IBGZPJMESA-N |
| XLogP | 4.89 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|