C23H27F6N3O4S2 — CID 56932571
1,1,1,3,3,3-hexafluoro-2-[4-[(2S)-2-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 56932571) has the molecular formula C23H27F6N3O4S2 and a molecular weight of 587.61 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[(2S)-2-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(2S)-2-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 56932571 |
| Molecular Formula | C23H27F6N3O4S2 |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(2S)-2-[[(3S)-3-methylmorpholin-4-yl]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@H]1COCCN1C[C@H]1CN(S(=O)(=O)c2cccs2)CCN1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H27F6N3O4S2/c1-16-15-36-11-10-30(16)13-19-14-31(38(34,35)20-3-2-12-37-20)8-9-32(19)18-6-4-17(5-7-18)21(33,22(24,25)26)23(27,28)29/h2-7,12,16,19,33H,8-11,13-15H2,1H3/t16-,19-/m0/s1 |
| InChIKey | LJKUKPPCBQEXTR-LPHOPBHVSA-N |
| XLogP | 3.66 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|