C24H32F3N3O4S2 — CID 66582390
2-[4-[(2S)-2-[(3-ethylmorpholin-4-yl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 66582390) has the molecular formula C24H32F3N3O4S2 and a molecular weight of 547.67 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[(3-ethylmorpholin-4-yl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-2-[(3-ethylmorpholin-4-yl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 66582390 |
| Molecular Formula | C24H32F3N3O4S2 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 2-[4-[(2S)-2-[(3-ethylmorpholin-4-yl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCC1COCCN1C[C@H]1CN(S(=O)(=O)c2cccs2)CCN1c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H32F3N3O4S2/c1-3-19-17-34-13-12-28(19)15-21-16-29(36(32,33)22-5-4-14-35-22)10-11-30(21)20-8-6-18(7-9-20)23(2,31)24(25,26)27/h4-9,14,19,21,31H,3,10-13,15-17H2,1-2H3/t19?,21-,23?/m0/s1 |
| InChIKey | WTIZOCLETXHLIP-SWCONJRYSA-N |
| XLogP | 3.51 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|