C25H24F6N2O4S2 — CID 87058562
1,1,1,3,3,3-hexafluoro-2-[4-[(2R)-2-[(2-methoxyphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 87058562) has the molecular formula C25H24F6N2O4S2 and a molecular weight of 594.60 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[(2R)-2-[(2-methoxyphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(2R)-2-[(2-methoxyphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 87058562 |
| Molecular Formula | C25H24F6N2O4S2 |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(2R)-2-[(2-methoxyphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | COc1ccccc1C[C@@H]1CN(S(=O)(=O)c2cccs2)CCN1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H24F6N2O4S2/c1-37-21-6-3-2-5-17(21)15-20-16-32(39(35,36)22-7-4-14-38-22)12-13-33(20)19-10-8-18(9-11-19)23(34,24(26,27)28)25(29,30)31/h2-11,14,20,34H,12-13,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | YBCJQAJGJLGUHB-HXUWFJFHSA-N |
| XLogP | 5.19 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|