C25H27F3N2O4S2 — CID 149188809
1,1,1-trifluoro-2-[4-[(2S)-2-[(4-methoxyphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 149188809) has the molecular formula C25H27F3N2O4S2 and a molecular weight of 540.63 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[4-[(2S)-2-[(4-methoxyphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[4-[(2S)-2-[(4-methoxyphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 149188809 |
| Molecular Formula | C25H27F3N2O4S2 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 1,1,1-trifluoro-2-[4-[(2S)-2-[(4-methoxyphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | COc1ccc(C[C@H]2CN(S(=O)(=O)c3cccs3)CCN2c2ccc(C(C)(O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H27F3N2O4S2/c1-24(31,25(26,27)28)19-7-9-20(10-8-19)30-14-13-29(36(32,33)23-4-3-15-35-23)17-21(30)16-18-5-11-22(34-2)12-6-18/h3-12,15,21,31H,13-14,16-17H2,1-2H3/t21-,24?/m0/s1 |
| InChIKey | XCKIUQQGQSXLNW-XEGCMXMBSA-N |
| XLogP | 4.65 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|