C22H29F3N2O4S2 — CID 66582953
2-[4-[(2R)-2-(butoxymethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 66582953) has the molecular formula C22H29F3N2O4S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 2-[4-[(2R)-2-(butoxymethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-[(2R)-2-(butoxymethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 66582953 |
| Molecular Formula | C22H29F3N2O4S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | 2-[4-[(2R)-2-(butoxymethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CCCCOC[C@H]1CN(S(=O)(=O)c2cccs2)CCN1c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H29F3N2O4S2/c1-3-4-13-31-16-19-15-26(33(29,30)20-6-5-14-32-20)11-12-27(19)18-9-7-17(8-10-18)21(2,28)22(23,24)25/h5-10,14,19,28H,3-4,11-13,15-16H2,1-2H3/t19-,21?/m1/s1 |
| InChIKey | POPMCECYAJLFFG-YMBRHYMPSA-N |
| XLogP | 4.21 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|