C25H25ClF6N2O3S2 — CID 86670320
1,1,1,3,3,3-hexafluoro-2-[4-[(2S)-2-[(4-methylphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol;hydrochloride (PubChem CID 86670320) has the molecular formula C25H25ClF6N2O3S2 and a molecular weight of 615.06 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[(2S)-2-[(4-methylphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol;hydrochloride.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(2S)-2-[(4-methylphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 86670320 |
| Molecular Formula | C25H25ClF6N2O3S2 |
| Molecular Weight | 615.06 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(2S)-2-[(4-methylphenyl)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol;hydrochloride |
| SMILES | Cc1ccc(C[C@H]2CN(S(=O)(=O)c3cccs3)CCN2c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1.Cl |
| InChI | InChI=1S/C25H24F6N2O3S2.ClH/c1-17-4-6-18(7-5-17)15-21-16-32(38(35,36)22-3-2-14-37-22)12-13-33(21)20-10-8-19(9-11-20)23(34,24(26,27)28)25(29,30)31;/h2-11,14,21,34H,12-13,15-16H2,1H3;1H/t21-;/m0./s1 |
| InChIKey | BOVAFLRPORCBBW-BOXHHOBZSA-N |
| XLogP | 5.91 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.06 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|