C23H26F6N2O4S2 — CID 86670315
1,1,1,3,3,3-hexafluoro-2-[4-[(2R)-2-(oxan-4-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 86670315) has the molecular formula C23H26F6N2O4S2 and a molecular weight of 572.59 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[(2R)-2-(oxan-4-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(2R)-2-(oxan-4-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 86670315 |
| Molecular Formula | C23H26F6N2O4S2 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[(2R)-2-(oxan-4-ylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | O=S(=O)(c1cccs1)N1CCN(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@H](CC2CCOCC2)C1 |
| InChI | InChI=1S/C23H26F6N2O4S2/c24-22(25,26)21(32,23(27,28)29)17-3-5-18(6-4-17)31-10-9-30(37(33,34)20-2-1-13-36-20)15-19(31)14-16-7-11-35-12-8-16/h1-6,13,16,19,32H,7-12,14-15H2/t19-/m1/s1 |
| InChIKey | ZIIICKIMOSZOAK-LJQANCHMSA-N |
| XLogP | 4.76 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|