C24H34N2O3S2 — CID 70659462
2-[4-[(2R)-2-(cyclohexylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 70659462) has the molecular formula C24H34N2O3S2 and a molecular weight of 462.68 g/mol. Its IUPAC name is 2-[4-[(2R)-2-(cyclohexylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[(2R)-2-(cyclohexylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70659462 |
| Molecular Formula | C24H34N2O3S2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 2-[4-[(2R)-2-(cyclohexylmethyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@H]2CC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H34N2O3S2/c1-24(2,27)20-10-12-21(13-11-20)26-15-14-25(31(28,29)23-9-6-16-30-23)18-22(26)17-19-7-4-3-5-8-19/h6,9-13,16,19,22,27H,3-5,7-8,14-15,17-18H2,1-2H3/t22-/m1/s1 |
| InChIKey | XWWGUCYFDQCGIZ-JOCHJYFZSA-N |
| XLogP | 4.83 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|