C23H33N3O4S2 — CID 70659528
2-[4-[(2S)-2-[(oxan-4-ylamino)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 70659528) has the molecular formula C23H33N3O4S2 and a molecular weight of 479.67 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[(oxan-4-ylamino)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[(2S)-2-[(oxan-4-ylamino)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70659528 |
| Molecular Formula | C23H33N3O4S2 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 2-[4-[(2S)-2-[(oxan-4-ylamino)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CNC2CCOCC2)cc1 |
| InChI | InChI=1S/C23H33N3O4S2/c1-23(2,27)18-5-7-20(8-6-18)26-12-11-25(32(28,29)22-4-3-15-31-22)17-21(26)16-24-19-9-13-30-14-10-19/h3-8,15,19,21,24,27H,9-14,16-17H2,1-2H3/t21-/m0/s1 |
| InChIKey | FCWROINVYKMOKY-NRFANRHFSA-N |
| XLogP | 2.62 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|