C23H36N4O5S3 — CID 70659618
2-[4-[(2R)-2-[[dimethylsulfamoyl(propan-2-yl)amino]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 70659618) has the molecular formula C23H36N4O5S3 and a molecular weight of 544.77 g/mol. Its IUPAC name is 2-[4-[(2R)-2-[[dimethylsulfamoyl(propan-2-yl)amino]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[(2R)-2-[[dimethylsulfamoyl(propan-2-yl)amino]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70659618 |
| Molecular Formula | C23H36N4O5S3 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 2-[4-[(2R)-2-[[dimethylsulfamoyl(propan-2-yl)amino]methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CC(C)N(C[C@H]1CN(S(=O)(=O)c2cccs2)CCN1c1ccc(C(C)(C)O)cc1)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C23H36N4O5S3/c1-18(2)27(35(31,32)24(5)6)17-21-16-25(34(29,30)22-8-7-15-33-22)13-14-26(21)20-11-9-19(10-12-20)23(3,4)28/h7-12,15,18,21,28H,13-14,16-17H2,1-6H3/t21-/m1/s1 |
| InChIKey | MJXSBEFSLLUION-OAQYLSRUSA-N |
| XLogP | 2.37 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|