C50H62N6O10S6 — CID 159772786
N-[[(2R)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]-N-phenylmethanesulfonamide (PubChem CID 159772786) has the molecular formula C50H62N6O10S6 and a molecular weight of 1099.48 g/mol. Its IUPAC name is N-[[(2R)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]-N-phenylmethanesulfonamide.
| Compound Name | N-[[(2R)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]-N-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 159772786 |
| Molecular Formula | C50H62N6O10S6 |
| Molecular Weight | 1099.48 g/mol |
| Exact Mass | 1098.29 |
| IUPAC Name | N-[[(2R)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]-N-phenylmethanesulfonamide |
| SMILES | CC(C)(O)c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CN(c2ccccc2)S(C)(=O)=O)cc1.CC(C)(O)c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CN(c2ccccc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/2C25H31N3O5S3/c2*1-25(2,29)20-11-13-21(14-12-20)27-16-15-26(36(32,33)24-10-7-17-34-24)18-23(27)19-28(35(3,30)31)22-8-5-4-6-9-22/h2*4-14,17,23,29H,15-16,18-19H2,1-3H3/t2*23-/m11/s1 |
| InChIKey | NGIJYSNJXZIMOX-RFAQQLIWSA-N |
| XLogP | 6.64 |
| TPSA | 196.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|