C48H68F6N6O10S6 — CID 162132865
2,2,2-trifluoro-N-[[(2S)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]-N-(2-methylpropyl)ethanesulfonamide (PubChem CID 162132865) has the molecular formula C48H68F6N6O10S6 and a molecular weight of 1195.49 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(2S)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]-N-(2-methylpropyl)ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[[(2S)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]-N-(2-methylpropyl)ethanesulfonamide |
|---|---|
| PubChem CID | 162132865 |
| Molecular Formula | C48H68F6N6O10S6 |
| Molecular Weight | 1195.49 g/mol |
| Exact Mass | 1194.32 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(2S)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]-N-(2-methylpropyl)ethanesulfonamide |
| SMILES | CC(C)CN(C[C@H]1CN(S(=O)(=O)c2cccs2)CCN1c1ccc(C(C)(C)O)cc1)S(=O)(=O)CC(F)(F)F.CC(C)CN(C[C@H]1CN(S(=O)(=O)c2cccs2)CCN1c1ccc(C(C)(C)O)cc1)S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/2C24H34F3N3O5S3/c2*1-18(2)14-29(37(32,33)17-24(25,26)27)16-21-15-28(38(34,35)22-6-5-13-36-22)11-12-30(21)20-9-7-19(8-10-20)23(3,4)31/h2*5-10,13,18,21,31H,11-12,14-17H2,1-4H3/t2*21-/m11/s1 |
| InChIKey | ZIWVQXWTEZQSAD-PRFAJPDFSA-N |
| XLogP | 7.41 |
| TPSA | 196.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1195.49 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|