C25H31N3O3S2 — CID 70659870
2-[4-[(2S)-2-[(benzylamino)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 70659870) has the molecular formula C25H31N3O3S2 and a molecular weight of 485.68 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[(benzylamino)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[(2S)-2-[(benzylamino)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70659870 |
| Molecular Formula | C25H31N3O3S2 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 2-[4-[(2S)-2-[(benzylamino)methyl]-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CNCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H31N3O3S2/c1-25(2,29)21-10-12-22(13-11-21)28-15-14-27(33(30,31)24-9-6-16-32-24)19-23(28)18-26-17-20-7-4-3-5-8-20/h3-13,16,23,26,29H,14-15,17-19H2,1-2H3/t23-/m0/s1 |
| InChIKey | IVTDZLIEBIBMMU-QHCPKHFHSA-N |
| XLogP | 3.64 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|