C24H28FN3O5S3 — CID 70659708
4-fluoro-N-[[(2S)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]benzenesulfonamide (PubChem CID 70659708) has the molecular formula C24H28FN3O5S3 and a molecular weight of 553.70 g/mol. Its IUPAC name is 4-fluoro-N-[[(2S)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[[(2S)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70659708 |
| Molecular Formula | C24H28FN3O5S3 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | 4-fluoro-N-[[(2S)-1-[4-(2-hydroxypropan-2-yl)phenyl]-4-thiophen-2-ylsulfonylpiperazin-2-yl]methyl]benzenesulfonamide |
| SMILES | CC(C)(O)c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2CNS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H28FN3O5S3/c1-24(2,29)18-5-9-20(10-6-18)28-14-13-27(36(32,33)23-4-3-15-34-23)17-21(28)16-26-35(30,31)22-11-7-19(25)8-12-22/h3-12,15,21,26,29H,13-14,16-17H2,1-2H3/t21-/m0/s1 |
| InChIKey | VXEVOCLLMPPMAC-NRFANRHFSA-N |
| XLogP | 2.97 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|