C23H21Cl2F3N2O3S2 — CID 66582320
(2S)-2-[4-[(2S)-2-(2,5-dichlorophenyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 66582320) has the molecular formula C23H21Cl2F3N2O3S2 and a molecular weight of 565.47 g/mol. Its IUPAC name is (2S)-2-[4-[(2S)-2-(2,5-dichlorophenyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-2-[4-[(2S)-2-(2,5-dichlorophenyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 66582320 |
| Molecular Formula | C23H21Cl2F3N2O3S2 |
| Molecular Weight | 565.47 g/mol |
| Exact Mass | 564.03 |
| IUPAC Name | (2S)-2-[4-[(2S)-2-(2,5-dichlorophenyl)-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)c3cccs3)C[C@@H]2c2cc(Cl)ccc2Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C23H21Cl2F3N2O3S2/c1-22(31,23(26,27)28)15-4-7-17(8-5-15)30-11-10-29(35(32,33)21-3-2-12-34-21)14-20(30)18-13-16(24)6-9-19(18)25/h2-9,12-13,20,31H,10-11,14H2,1H3/t20-,22+/m1/s1 |
| InChIKey | UWRXVXWZYGQAJA-IRLDBZIGSA-N |
| XLogP | 6.08 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|