C25H23Cl2F3N2O3S2 — CID 87058425
2-[(3R)-3-(2,5-dichlorophenyl)-4-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 87058425) has the molecular formula C25H23Cl2F3N2O3S2 and a molecular weight of 591.50 g/mol. Its IUPAC name is 2-[(3R)-3-(2,5-dichlorophenyl)-4-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
| Compound Name | 2-[(3R)-3-(2,5-dichlorophenyl)-4-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87058425 |
| Molecular Formula | C25H23Cl2F3N2O3S2 |
| Molecular Weight | 591.50 g/mol |
| Exact Mass | 590.05 |
| IUPAC Name | 2-[(3R)-3-(2,5-dichlorophenyl)-4-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | C[C@@](O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)C[C@H]2c2cc(Cl)ccc2Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H23Cl2F3N2O3S2/c1-24(33,25(28,29)30)16-6-9-18(10-7-16)32-13-12-31(37(34,35)23-5-3-2-4-22(23)36)15-21(32)19-14-17(26)8-11-20(19)27/h2-3,5-11,14,21,33H,4,12-13,15H2,1H3/t21-,24+/m0/s1 |
| InChIKey | IFCUMFYZHFWEAT-XUZZJYLKSA-N |
| XLogP | 6.17 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|