C21H22F3N3O3S2 — CID 87058271
2-[4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]acetonitrile (PubChem CID 87058271) has the molecular formula C21H22F3N3O3S2 and a molecular weight of 485.55 g/mol. Its IUPAC name is 2-[4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]acetonitrile.
| Compound Name | 2-[4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 87058271 |
| Molecular Formula | C21H22F3N3O3S2 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 2-[4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]acetonitrile |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)CC2CC#N)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H22F3N3O3S2/c1-20(28,21(22,23)24)15-6-8-16(9-7-15)27-13-12-26(14-17(27)10-11-25)32(29,30)19-5-3-2-4-18(19)31/h2-3,5-9,17,28H,4,10,12-14H2,1H3 |
| InChIKey | YEPDJKFGEPLYLS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|