C25H30F3N3O4S2 — CID 87058509
1-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]piperidin-4-one (PubChem CID 87058509) has the molecular formula C25H30F3N3O4S2 and a molecular weight of 557.66 g/mol. Its IUPAC name is 1-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]piperidin-4-one.
| Compound Name | 1-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]piperidin-4-one |
|---|---|
| PubChem CID | 87058509 |
| Molecular Formula | C25H30F3N3O4S2 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | 1-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]piperidin-4-one |
| SMILES | C[C@@](O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)C[C@@H]2CN2CCC(=O)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H30F3N3O4S2/c1-24(33,25(26,27)28)18-6-8-19(9-7-18)31-15-14-30(37(34,35)23-5-3-2-4-22(23)36)17-20(31)16-29-12-10-21(32)11-13-29/h2-3,5-9,20,33H,4,10-17H2,1H3/t20-,24+/m0/s1 |
| InChIKey | SQVFTZREKWIEQL-GBXCKJPGSA-N |
| XLogP | 3.16 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|