C25H30F6N4O3S2 — CID 87059170
2-[(3S)-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]-3-[[(3S)-3-(trifluoromethyl)piperazin-1-yl]methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 87059170) has the molecular formula C25H30F6N4O3S2 and a molecular weight of 612.66 g/mol. Its IUPAC name is 2-[(3S)-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]-3-[[(3S)-3-(trifluoromethyl)piperazin-1-yl]methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
| Compound Name | 2-[(3S)-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]-3-[[(3S)-3-(trifluoromethyl)piperazin-1-yl]methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87059170 |
| Molecular Formula | C25H30F6N4O3S2 |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | 2-[(3S)-4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]-3-[[(3S)-3-(trifluoromethyl)piperazin-1-yl]methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)C[C@@H]2CN2CCN[C@H](C(F)(F)F)C2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H30F6N4O3S2/c1-23(36,25(29,30)31)17-6-8-18(9-7-17)35-13-12-34(40(37,38)21-5-3-2-4-20(21)39)15-19(35)14-33-11-10-32-22(16-33)24(26,27)28/h2-3,5-9,19,22,32,36H,4,10-16H2,1H3/t19-,22-,23-/m0/s1 |
| InChIKey | BFYWJTCCRCKFFP-VJBMBRPKSA-N |
| XLogP | 3.33 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|