C26H29F3N4O5S2 — CID 87058708
5-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 87058708) has the molecular formula C26H29F3N4O5S2 and a molecular weight of 598.67 g/mol. Its IUPAC name is 5-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 5-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 87058708 |
| Molecular Formula | C26H29F3N4O5S2 |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | 5-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | C[C@@](O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)C[C@@H]2CN2C(=O)NC(=O)C23CCC3)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H29F3N4O5S2/c1-24(36,26(27,28)29)17-7-9-18(10-8-17)32-14-13-31(40(37,38)21-6-3-2-5-20(21)39)15-19(32)16-33-23(35)30-22(34)25(33)11-4-12-25/h2-3,6-10,19,36H,4-5,11-16H2,1H3,(H,30,34,35)/t19-,24-/m1/s1 |
| InChIKey | HKDMFMHSWCLQOR-NTKDMRAZSA-N |
| XLogP | 2.96 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|