C24H29F3N4O4S2 — CID 87058656
4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]piperazin-2-one (PubChem CID 87058656) has the molecular formula C24H29F3N4O4S2 and a molecular weight of 558.65 g/mol. Its IUPAC name is 4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]piperazin-2-one.
| Compound Name | 4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 87058656 |
| Molecular Formula | C24H29F3N4O4S2 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | 4-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]piperazin-2-one |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)C[C@@H]2CN2CCNC(=O)C2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H29F3N4O4S2/c1-23(33,24(25,26)27)17-6-8-18(9-7-17)31-13-12-30(37(34,35)21-5-3-2-4-20(21)36)15-19(31)14-29-11-10-28-22(32)16-29/h2-3,5-9,19,33H,4,10-16H2,1H3,(H,28,32)/t19-,23?/m0/s1 |
| InChIKey | XKLXXWPEBXKSCI-HSTJUUNISA-N |
| XLogP | 1.92 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|