C26H26F4N2O3S2 — CID 87058183
2-[(3S)-3-[(4-fluorophenyl)methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 87058183) has the molecular formula C26H26F4N2O3S2 and a molecular weight of 554.63 g/mol. Its IUPAC name is 2-[(3S)-3-[(4-fluorophenyl)methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
| Compound Name | 2-[(3S)-3-[(4-fluorophenyl)methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87058183 |
| Molecular Formula | C26H26F4N2O3S2 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 2-[(3S)-3-[(4-fluorophenyl)methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)C[C@@H]2Cc2ccc(F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H26F4N2O3S2/c1-25(33,26(28,29)30)19-8-12-21(13-9-19)32-15-14-31(37(34,35)24-5-3-2-4-23(24)36)17-22(32)16-18-6-10-20(27)11-7-18/h2-3,5-13,22,33H,4,14-17H2,1H3/t22-,25?/m0/s1 |
| InChIKey | ZZDBZFZVPITYBF-XADRRFQNSA-N |
| XLogP | 4.87 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|